C16H16N2O9S1
412.37
InChI=1S/C16H18N2O9S/c1-7(19)27-5-8-6-28-14-11(13(22)18(14)12(8)16(25)26)17-10(21)4-2-3-9(20)15(23)24/h11,14H,2-6H2,1H3,(H,17,21)(H,23,24)(H,25,26)/p-2/t11-,14-/m1/s1
InChIKey=UKRMDFPJXIVYCZ-BXUZGUMPSA-L
CC(=O)OCC1(CSC2(C(NC(=O)CCCC(=O)C(=O)[O-])C(=O)N(C(C(=O)[O-])=1)2))
25203468