C14H19N1O14S1
457.362
InChI=1S/C14H21NO14S/c1-4(16)15-8-11(10(19)7(27-13(8)22)3-26-30(23,24)25)29-14-9(18)5(17)2-6(28-14)12(20)21/h2,5,7-11,13-14,17-19,22H,3H2,1H3,(H,15,16)(H,20,21)(H,23,24,25)/p-2/t5-,7+,8+,9+,10-,11+,13?,14-/m0/s1
InChIKey=BUJZTFINDCQRGP-ZTVLJYEESA-L
CC(=O)NC2(C(O)OC(COS(=O)(=O)[O-])C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)
46931111