C6H4N1O5S1
202.161
InChI=1S/C6H5NO5S/c8-7(9)5-2-1-3-6(4-5)13(10,11)12/h1-4H,(H,10,11,12)/p-1
InChIKey=ONMOULMPIIOVTQ-UHFFFAOYSA-M
C1(C=C([N+](=O)[O-])C=C(C=1)S([O-])(=O)=O)
3906961