C33H56N1O7
578.808
InChI=1S/C33H55NO7/c1-17-7-12-33(34-15-17)18(2)26-24(41-33)14-23-21-6-5-19-13-20(8-10-31(19,3)22(21)9-11-32(23,26)4)39-30-29(38)28(37)27(36)25(16-35)40-30/h17-30,34-38H,5-16H2,1-4H3/p+1/t17-,18-,19-,20-,21+,22-,23-,24-,25+,26-,27+,28-,29+,30?,31-,32-,33-/m0/s1
InChIKey=JDRMNHOIHYWSFN-MULVFALLSA-O
CC1(CCC2([N+]C1)(OC3(C(C(C)2)C6(C)(C(C3)C7(CCC5(CC(OC4(OC(CO)C(O)C(O)C(O)4))CCC(C)5C(CC6)7))))))
44237317