C6H4O6S2
236.214
InChI=1S/C6H6O6S2/c7-13(8,9)5-2-1-3-6(4-5)14(10,11)12/h1-4H,(H,7,8,9)(H,10,11,12)/p-2
InChIKey=WRUAHXANJKHFIL-UHFFFAOYSA-L
C1(=CC(S(=O)(=O)[O-])=CC(S(=O)(=O)[O-])=C1)
117448