C14H9N3O5S1
331.302
InChI=1S/C14H11N3O5S/c1-17-11-4-7(15)2-3-10(11)16-13-9(14(18)19)5-8(6-12(13)17)23(20,21)22/h2-6,15H,1H3,(H,18,19)(H,20,21,22)/p-2/b15-7+
InChIKey=MAAJOYIJLQLODY-VIZOYTHASA-L
CN3(C1(=CC(C=CC1=NC2(C(C(=O)[O-])=CC(S(=O)(=O)[O-])=CC=23))=[NH]))
25200715