C15H26O1
222.37
InChI=1S/C15H26O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11,16H,5-6,8,10,12H2,1-4H3/b14-9+,15-11-
InChIKey=CRDAMVZIKSXKFV-PVMFERMNSA-N
CC(=CCCC(=CCCC(=CCO)C)C)C
1549108