C10H10O5S1
242.246
InChI=1S/C10H12O5S/c1-2-9(10(11)12)7-3-5-8(6-4-7)16(13,14)15/h3-6,9H,2H2,1H3,(H,11,12)(H,13,14,15)/p-2
InChIKey=UBOLIQIJRBLRGQ-UHFFFAOYSA-L
CCC(C(=O)[O-])C1(=CC=C(S(=O)(=O)[O-])C=C1)
25202167