C10H7O3S1
207.223
InChI=1S/C10H8O3S/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H,11,12,13)/p-1
InChIKey=PSZYNBSKGUBXEH-UHFFFAOYSA-M
C2(C=CC1(=C(S(=O)(=O)[O-])C=CC=C1C=2))
4224596