C6H10O6
178.141
InChI=1S/C6H10O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-3,5-8,10-11H,1H2/t2-,3-,5-,6+/m1/s1
InChIKey=APIQNBNBIICCON-KWDZRWNJSA-N
C(O)C1(OC(C(C(C1O)=O)O)O)
25201314