C20H19N2O3
335.382
InChI=1S/C20H20N2O3/c1-9(23)14-18(24)17-16-11-8-21-13-6-4-5-10(15(11)13)7-12(16)20(2,3)22(17)19(14)25/h4-6,8,12,16-17,21,23H,7H2,1-3H3/p-1/b14-9-/t12-,16+,17+/m1/s1
InChIKey=CNZIQHGDUXRUJS-PTNHGACKSA-M
CC(=C2(C(N1(C(C5(C(C1C2=O)C3(C4(=C(NC=3)C=CC=C4C5))))(C)C))=O))[O-]
25244026