C20H25N3S1CL1
374.951
InChI=1S/C20H24ClN3S/c1-22-11-13-23(14-12-22)9-4-10-24-17-5-2-3-6-19(17)25-20-8-7-16(21)15-18(20)24/h2-3,5-8,15H,4,9-14H2,1H3/p+1
InChIKey=WIKYUJGCLQQFNW-UHFFFAOYSA-O
CN4(CC[N+](CCCN1(C3(=C(SC2(=C1C=CC=C2))C=CC(Cl)=C3)))CC4)
25203624