C20H21N2O3
337.397
InChI=1S/C20H22N2O3/c1-11(2)7-8-13-5-4-6-15-18(13)14(10-21-15)9-16-19(24)17(12(3)23)20(25)22-16/h4-7,10,16,21,23H,8-9H2,1-3H3,(H,22,25)/p-1/b17-12-/t16-/m0/s1
InChIKey=HLDTVPRYVAHRIQ-BQGMYUGNSA-M
CC(=CCC3(C2(=C(NC=C(CC1(NC(C(C1=O)=C(C)[O-])=O))2)C=CC=3)))C
25244243