C22H33N4O13
561.522
InChI=1S/C22H36N4O13/c1-13(27)25(38)9-5-3-7-15(19(31)32)23-17(29)11-22(37,21(35)36)12-18(30)24-16(20(33)34)8-4-6-10-26(39)14(2)28/h15-16,37-39H,3-12H2,1-2H3,(H,23,29)(H,24,30)(H,31,32)(H,33,34)(H,35,36)/p-3/t15-,16-/m0/s1
InChIKey=KDHHWXGBNUCREU-HOTGVXAUSA-K
CC(=O)N(CCCCC(NC(CC(C(=O)[O-])(O)CC(=O)NC(C(=O)[O-])CCCCN(C(C)=O)O)=O)C([O-])=O)O
25244827

Bioactivities(StreptomeDB)

antibiotic