C10H16N3O6S2
338.373
InChI=1S/C10H17N3O6S2/c11-5(10(18)19)1-2-7(14)13-6(4-21-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/p-1/t5-,6-/m0/s1
InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M
C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
46878477