C20H29O3
317.447
InChI=1S/C20H30O3/c1-2-3-13-16-19(21)17-14-11-9-7-5-4-6-8-10-12-15-18-20(22)23/h4-5,8-11,14,17H,2-3,6-7,12-13,15-16,18H2,1H3,(H,22,23)/p-1/b5-4-,10-8-,11-9-,17-14+
InChIKey=YGJTUEISKATQSM-USWFWKISSA-M
CCCCCC(=O)C=CC=CCC=CCC=CCCCC(=O)[O-]
25244796