C14H23N3O14P2
519.295
InChI=1S/C14H25N3O14P2/c1-14(23,6-18)8(19)5-29-33(26,27)31-32(24,25)28-4-7-10(20)11(21)12(30-7)17-3-2-9(15)16-13(17)22/h2-3,7-8,10-12,18-21,23H,4-6H2,1H3,(H,24,25)(H,26,27)(H2,15,16,22)/p-2/t7-,8-,10-,11-,12-,14+/m1/s1
InChIKey=YFAUKWZNPVBCFF-XHIBXCGHSA-L
CC(O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(O)C(O)C(N1(C=CC(N)=NC(=O)1))O2))([O-])=O
24970669

天然来源

Aspergillus flavusArabidopsis thalianaAspergillus terreusChlamydomonas reinhardtiiCatharanthus roseusCucumis sativusCamellia sinensisDendrobium catenatumStreptomyces himastatinicusStreptomyces mobaraensisStreptomyces prunicolorStreptomyces purpureusStreptomyces thermolilacinusStreptomyces niveusStreptomyces roseochromogenusStreptomyces peruviensisStreptomyces resistomycificusStreptomyces virginiaeStreptomyces yerevanensisStreptomyces pyridomyceticusStreptomyces violensStreptomyces purpeofuscusStreptomyces sclerotialusStreptomyces roseoverticillatusStreptomyces virginiaeStreptosporangium amethystogenesStreptomyces olivaceusStreptomyces ruberStreptomyces seoulensisStreptomyces xanthophaeusStreptomyces mutabilisStreptomyces lividansStreptomyces yeochonensisStreptomyces mirabilisStreptomyces sp. 769Streptomyces vietnamensisStreptomyces xiamenensisGlycyrrhiza uralensisMicromonospora aurantiacaMicromonospora lupiniMicromonospora sp. L5Medicago truncatulaPenicillium camembertiPanax ginsengSinopodophyllum hexandrumPanax notoginsengPanax quinquefoliusStreptomyces hygroscopicusStreptomyces hygroscopicusSalvia miltiorrhizaStreptomyces rapamycinicusStreptomyces rimosusStreptomyces roseosporusStreptomyces roseosporusStreptosporangium roseumStreptomyces scabieiStreptomyces somaliensisStreptomyces sp. W007Streptomyces sp. SM8Streptomyces sp. PAMC26508Streptomyces sp. CStreptomyces sp. Tu6071Streptomyces sp. e14Streptomyces sp. SA3_actFStreptomyces sp. SA3_actGStreptomyces sp. SirexAA-EStreptomyces sp. S4Streptomyces sviceusStreptomyces tsukubaensisStreptomyces turgidiscabiesStreptomyces venezuelaeStreptomyces violaceusnigerStreptomyces viridochromogenesStreptomyces viridochromogenesStreptomyces zinciresistens