C15H9O8
317.231
InChI=1S/C15H10O8/c16-6-2-1-5(3-7(6)17)14-13(22)12(21)10-8(18)4-9(19)11(20)15(10)23-14/h1-4,16-20,22H/p-1
InChIKey=YRRAGUMVDQQZIY-UHFFFAOYSA-M
C1(C=C(C(=CC=1C3(=C(C(C2(=C(C=C(C(=C2O3)O)O)O))=O)[O-]))O)O)
25201917