C15H24
204.355
InChI=1S/C15H24/c1-11(2)6-5-9-15(4)12(3)13-7-8-14(15)10-13/h6,13-14H,3,5,7-10H2,1-2,4H3
InChIKey=PGBNIHXXFQBCPU-UHFFFAOYSA-N
CC(C)=CCCC1(C)(C(=C)C2(CC1CC2))
10534