C37H46N1O12
696.77
InChI=1S/C37H47NO12/c1-16-11-10-12-17(2)36(46)38-23-15-24(40)26-27(32(23)44)31(43)21(6)34-28(26)35(45)37(8,50-34)48-14-13-25(47-9)18(3)33(49-22(7)39)20(5)30(42)19(4)29(16)41/h10-16,18-20,25,29-30,33,40-44H,1-9H3,(H,38,46)/p-1/b11-10+,14-13+,17-12-/t16-,18+,19+,20+,25-,29-,30+,33+,37-/m0/s1
InChIKey=HJYYPODYNSCCOU-ODRIEIDWSA-M
CC2(C=CC=C(C)C(=O)NC1(C=C(O)C4(=C(C(O)=1)C([O-])=C(C)C3(OC(OC=CC(OC)C(C)C(C(C)C(O)C(C)C(O)2)OC(=O)C)(C)C(=O)C=34))))
25245454