C6H11O8S1
243.208
InChI=1S/C6H12O8S/c7-3-2(1-15(11,12)13)14-6(10)5(9)4(3)8/h2-10H,1H2,(H,11,12,13)/p-1/t2-,3-,4+,5-,6?/m1/s1
InChIKey=QFBWOLBPVQLZEH-GASJEMHNSA-M
C(C1(OC(O)C(O)C(O)C(O)1))S(=O)(=O)[O-]
86289062