C20H29O2
301.448
InChI=1S/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,11-16H,2,5,8-10,17-19H2,1H3,(H,21,22)/p-1/b4-3-,7-6-,12-11+,14-13+,16-15-
InChIKey=XGTCGDUVXWLURC-FZNBEQTOSA-M
CCC=CCC=CCCCC=CC=CC=CCCCC(=O)[O-]
25244784