C20H31O5
351.462
InChI=1S/C20H32O5/c21-17-10-6-2-1-3-7-12-18(22)13-8-4-5-9-14-19(23)15-11-16-20(24)25/h3-5,7-9,13-14,18-19,21-23H,1-2,6,10-12,15-17H2,(H,24,25)/p-1/b5-4+,7-3-,13-8+,14-9-/t18-,19-/m1/s1
InChIKey=PTJFJXLGRSTECQ-PSPARDEHSA-M
C(O)CCCCC=CCC(O)C=CC=CC=CC(O)CCCC(=O)[O-]
23615494