C16H31O4
287.418
InChI=1S/C16H32O4/c17-14-10-6-5-8-12-15(18)11-7-3-1-2-4-9-13-16(19)20/h15,17-18H,1-14H2,(H,19,20)/p-1
InChIKey=VJZBXAQGWLMYMS-UHFFFAOYSA-M
C(CCCCCC(O)CCCCCCCCC([O-])=O)O
25201518